C22H25N5OS2 — CID 42969086
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide (PubChem CID 42969086) has the molecular formula C22H25N5OS2 and a molecular weight of 439.61 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 42969086 |
| Molecular Formula | C22H25N5OS2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)acetamide |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)CSc3nnc4ccccn34)c2C#N)C1 |
| InChI | InChI=1S/C22H25N5OS2/c1-4-22(2,3)14-8-9-15-16(12-23)20(30-17(15)11-14)24-19(28)13-29-21-26-25-18-7-5-6-10-27(18)21/h5-7,10,14H,4,8-9,11,13H2,1-3H3,(H,24,28) |
| InChIKey | PSIVZWVKGHCELX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |