C21H27N5OS2 — CID 46692626
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 46692626) has the molecular formula C21H27N5OS2 and a molecular weight of 429.62 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 46692626 |
| Molecular Formula | C21H27N5OS2 |
| Molecular Weight | 429.62 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)CSc3nncn3C3CC3)c2C#N)C1 |
| InChI | InChI=1S/C21H27N5OS2/c1-4-21(2,3)13-5-8-15-16(10-22)19(29-17(15)9-13)24-18(27)11-28-20-25-23-12-26(20)14-6-7-14/h12-14H,4-9,11H2,1-3H3,(H,24,27) |
| InChIKey | UVLCPCHCMUVCSP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |