C26H31N5O2S2 — CID 19730572
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19730572) has the molecular formula C26H31N5O2S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19730572 |
| Molecular Formula | C26H31N5O2S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(3-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)CSc3nnc(-c4cccc(OC)c4)n3C)c2C#N)C1 |
| InChI | InChI=1S/C26H31N5O2S2/c1-6-26(2,3)17-10-11-19-20(14-27)24(35-21(19)13-17)28-22(32)15-34-25-30-29-23(31(25)4)16-8-7-9-18(12-16)33-5/h7-9,12,17H,6,10-11,13,15H2,1-5H3,(H,28,32) |
| InChIKey | UXTOBSAMFXVHCN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |