C24H29N5OS3 — CID 19719638
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-propyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19719638) has the molecular formula C24H29N5OS3 and a molecular weight of 499.73 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-propyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-propyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19719638 |
| Molecular Formula | C24H29N5OS3 |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-propyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCc1cc(-c2nnc(SCC(=O)Nc3sc4c(c3C#N)CCC(C)C4)n2CCC)cs1 |
| InChI | InChI=1S/C24H29N5OS3/c1-4-6-17-11-16(13-31-17)22-27-28-24(29(22)9-5-2)32-14-21(30)26-23-19(12-25)18-8-7-15(3)10-20(18)33-23/h11,13,15H,4-10,14H2,1-3H3,(H,26,30) |
| InChIKey | UNCQAFPSXSACOO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |