C27H30N6O2S2 — CID 126369639
N-[(1R)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 126369639) has the molecular formula C27H30N6O2S2 and a molecular weight of 534.71 g/mol. Its IUPAC name is N-[(1R)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | N-[(1R)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 126369639 |
| Molecular Formula | C27H30N6O2S2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[(1R)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1[C@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H30N6O2S2/c1-4-14-33-24(23(17(2)3)30-25(35)18-10-6-5-7-11-18)31-32-27(33)36-16-22(34)29-26-20(15-28)19-12-8-9-13-21(19)37-26/h4-7,10-11,17,23H,1,8-9,12-14,16H2,2-3H3,(H,29,34)(H,30,35)/t23-/m1/s1 |
| InChIKey | NVNQJXBDRDMCAG-HSZRJFAPSA-N |
| XLogP | 5.13 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|