C25H25ClFN5O2S2 — CID 19640910
2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)acetamide (PubChem CID 19640910) has the molecular formula C25H25ClFN5O2S2 and a molecular weight of 546.09 g/mol. Its IUPAC name is 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)acetamide.
| Compound Name | 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 19640910 |
| Molecular Formula | C25H25ClFN5O2S2 |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCCC3)nnc1C(C)Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C25H25ClFN5O2S2/c1-3-11-32-23(15(2)34-20-10-9-16(27)12-19(20)26)30-31-25(32)35-14-22(33)29-24-18(13-28)17-7-5-4-6-8-21(17)36-24/h3,9-10,12,15H,1,4-8,11,14H2,2H3,(H,29,33) |
| InChIKey | DKXKUIUQLICAHT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|