C27H30Cl2N4O4S2 — CID 19639978
propan-2-yl 2-[[2-[[5-[1-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19639978) has the molecular formula C27H30Cl2N4O4S2 and a molecular weight of 609.60 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[5-[1-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[[5-[1-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19639978 |
| Molecular Formula | C27H30Cl2N4O4S2 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | propan-2-yl 2-[[2-[[5-[1-(2,4-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCC3)nnc1C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H30Cl2N4O4S2/c1-5-12-33-24(16(4)37-20-11-10-17(28)13-19(20)29)31-32-27(33)38-14-22(34)30-25-23(26(35)36-15(2)3)18-8-6-7-9-21(18)39-25/h5,10-11,13,15-16H,1,6-9,12,14H2,2-4H3,(H,30,34) |
| InChIKey | TXERVTNZXAQGJZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|