C27H29ClN6O2S2 — CID 21379114
2-chloro-N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 21379114) has the molecular formula C27H29ClN6O2S2 and a molecular weight of 569.16 g/mol. Its IUPAC name is 2-chloro-N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | 2-chloro-N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 21379114 |
| Molecular Formula | C27H29ClN6O2S2 |
| Molecular Weight | 569.16 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-chloro-N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1C(NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C27H29ClN6O2S2/c1-4-13-34-24(23(16(2)3)31-25(36)18-10-5-7-11-20(18)28)32-33-27(34)37-15-22(35)30-26-19(14-29)17-9-6-8-12-21(17)38-26/h4-5,7,10-11,16,23H,1,6,8-9,12-13,15H2,2-3H3,(H,30,35)(H,31,36) |
| InChIKey | BWQJVULOBZCJSZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.16 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|