C24H25BrN6O2S2 — CID 2205385
2-bromo-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 2205385) has the molecular formula C24H25BrN6O2S2 and a molecular weight of 573.54 g/mol. Its IUPAC name is 2-bromo-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-bromo-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 2205385 |
| Molecular Formula | C24H25BrN6O2S2 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 2-bromo-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1[C@H](C)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H25BrN6O2S2/c1-3-31-21(14(2)27-22(33)16-9-4-6-10-18(16)25)29-30-24(31)34-13-20(32)28-23-17(12-26)15-8-5-7-11-19(15)35-23/h4,6,9-10,14H,3,5,7-8,11,13H2,1-2H3,(H,27,33)(H,28,32)/t14-/m0/s1 |
| InChIKey | MKJKFBDBIPJQIX-AWEZNQCLSA-N |
| XLogP | 5.09 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |