C23H23FN6O2S2 — CID 3541698
N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide (PubChem CID 3541698) has the molecular formula C23H23FN6O2S2 and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 3541698 |
| Molecular Formula | C23H23FN6O2S2 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-[1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
| SMILES | CC(NC(=O)c1ccccc1F)c1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCC3)n1C |
| InChI | InChI=1S/C23H23FN6O2S2/c1-13(26-21(32)15-8-3-5-9-17(15)24)20-28-29-23(30(20)2)33-12-19(31)27-22-16(11-25)14-7-4-6-10-18(14)34-22/h3,5,8-9,13H,4,6-7,10,12H2,1-2H3,(H,26,32)(H,27,31) |
| InChIKey | SHEDRTHEAUCTKS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |