C26H31N5O2S2 — CID 19637520
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19637520) has the molecular formula C26H31N5O2S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19637520 |
| Molecular Formula | C26H31N5O2S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(OC(C)c2nnc(SCC(=O)Nc3sc4c(c3C#N)CCCCCC4)n2C)c1C |
| InChI | InChI=1S/C26H31N5O2S2/c1-16-10-9-12-21(17(16)2)33-18(3)24-29-30-26(31(24)4)34-15-23(32)28-25-20(14-27)19-11-7-5-6-8-13-22(19)35-25/h9-10,12,18H,5-8,11,13,15H2,1-4H3,(H,28,32) |
| InChIKey | FZYUEKQCFCVHRU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |