C24H25FN6O2S2 — CID 4032436
N-[2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide (PubChem CID 4032436) has the molecular formula C24H25FN6O2S2 and a molecular weight of 512.64 g/mol. Its IUPAC name is N-[2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4032436 |
| Molecular Formula | C24H25FN6O2S2 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | N-[2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-2-fluorobenzamide |
| SMILES | CCn1c(CCNC(=O)c2ccccc2F)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C24H25FN6O2S2/c1-2-31-20(11-12-27-22(33)16-8-3-5-9-18(16)25)29-30-24(31)34-14-21(32)28-23-17(13-26)15-7-4-6-10-19(15)35-23/h3,5,8-9H,2,4,6-7,10-12,14H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | YWJSGVBFDICVFM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |