C24H26N6O3S2 — CID 3994471
2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 3994471) has the molecular formula C24H26N6O3S2 and a molecular weight of 510.65 g/mol. Its IUPAC name is 2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3994471 |
| Molecular Formula | C24H26N6O3S2 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCn1c(CC(=O)Nc2ccccc2OC)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C24H26N6O3S2/c1-3-30-20(12-21(31)26-17-9-5-6-10-18(17)33-2)28-29-24(30)34-14-22(32)27-23-16(13-25)15-8-4-7-11-19(15)35-23/h5-6,9-10H,3-4,7-8,11-12,14H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | HBUMYJYXULELBC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |