C22H21ClN6O2S2 — CID 4546715
N-(2-chlorophenyl)-2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetamide (PubChem CID 4546715) has the molecular formula C22H21ClN6O2S2 and a molecular weight of 501.04 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 4546715 |
| Molecular Formula | C22H21ClN6O2S2 |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-(2-chlorophenyl)-2-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]acetamide |
| SMILES | Cn1c(CC(=O)Nc2ccccc2Cl)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C22H21ClN6O2S2/c1-29-18(10-19(30)25-16-8-4-3-7-15(16)23)27-28-22(29)32-12-20(31)26-21-14(11-24)13-6-2-5-9-17(13)33-21/h3-4,7-8H,2,5-6,9-10,12H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | LAXWTEZFJGOKSJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |