C22H21Cl2N5O2S2 — CID 19632945
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19632945) has the molecular formula C22H21Cl2N5O2S2 and a molecular weight of 522.48 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19632945 |
| Molecular Formula | C22H21Cl2N5O2S2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[5-[(2,4-dichlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(COc2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCCC2 |
| InChI | InChI=1S/C22H21Cl2N5O2S2/c1-29-19(11-31-17-8-7-13(23)9-16(17)24)27-28-22(29)32-12-20(30)26-21-15(10-25)14-5-3-2-4-6-18(14)33-21/h7-9H,2-6,11-12H2,1H3,(H,26,30) |
| InChIKey | MIZZDPSBYODNFJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |