C24H26Cl2N4O4S2 — CID 17302636
methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17302636) has the molecular formula C24H26Cl2N4O4S2 and a molecular weight of 569.54 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17302636 |
| Molecular Formula | C24H26Cl2N4O4S2 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2nnc(CCCOc3ccc(Cl)cc3Cl)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C24H26Cl2N4O4S2/c1-30-19(8-5-11-34-17-10-9-14(25)12-16(17)26)28-29-24(30)35-13-20(31)27-22-21(23(32)33-2)15-6-3-4-7-18(15)36-22/h9-10,12H,3-8,11,13H2,1-2H3,(H,27,31) |
| InChIKey | QZUBJQCKYCPFSU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|