C27H26Cl2N4O5S2 — CID 17269534
methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 17269534) has the molecular formula C27H26Cl2N4O5S2 and a molecular weight of 621.57 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17269534 |
| Molecular Formula | C27H26Cl2N4O5S2 |
| Molecular Weight | 621.57 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | methyl 2-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CSc1nnc(CCCOc2ccc(Cl)cc2Cl)n1C |
| InChI | InChI=1S/C27H26Cl2N4O5S2/c1-33-22(5-4-12-38-21-11-8-17(28)13-20(21)29)31-32-27(33)40-15-23(34)30-25-24(26(35)37-3)19(14-39-25)16-6-9-18(36-2)10-7-16/h6-11,13-14H,4-5,12,15H2,1-3H3,(H,30,34) |
| InChIKey | XUVKYKFJSZRVCC-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|