C23H22Cl2N6O2S2 — CID 126358110
2,4-dichloro-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 126358110) has the molecular formula C23H22Cl2N6O2S2 and a molecular weight of 549.51 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126358110 |
| Molecular Formula | C23H22Cl2N6O2S2 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 2,4-dichloro-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C23H22Cl2N6O2S2/c1-2-31-19(11-27-21(33)15-8-7-13(24)9-17(15)25)29-30-23(31)34-12-20(32)28-22-16(10-26)14-5-3-4-6-18(14)35-22/h7-9H,2-6,11-12H2,1H3,(H,27,33)(H,28,32) |
| InChIKey | COGRLRVOFWENHY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |