C22H21BrN6O2S2 — CID 2968293
4-bromo-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 2968293) has the molecular formula C22H21BrN6O2S2 and a molecular weight of 545.49 g/mol. Its IUPAC name is 4-bromo-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-bromo-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2968293 |
| Molecular Formula | C22H21BrN6O2S2 |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 4-bromo-N-[[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | Cn1c(CNC(=O)c2ccc(Br)cc2)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C22H21BrN6O2S2/c1-29-18(11-25-20(31)13-6-8-14(23)9-7-13)27-28-22(29)32-12-19(30)26-21-16(10-24)15-4-2-3-5-17(15)33-21/h6-9H,2-5,11-12H2,1H3,(H,25,31)(H,26,30) |
| InChIKey | VPNNJRHUEWIMSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |