C25H25ClN6O2S2 — CID 126366597
2-chloro-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126366597) has the molecular formula C25H25ClN6O2S2 and a molecular weight of 541.10 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126366597 |
| Molecular Formula | C25H25ClN6O2S2 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 2-chloro-N-[(1S)-1-[5-[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCC3)nnc1[C@H](C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H25ClN6O2S2/c1-3-12-32-22(15(2)28-23(34)17-9-4-6-10-19(17)26)30-31-25(32)35-14-21(33)29-24-18(13-27)16-8-5-7-11-20(16)36-24/h3-4,6,9-10,15H,1,5,7-8,11-12,14H2,2H3,(H,28,34)(H,29,33)/t15-/m0/s1 |
| InChIKey | DRFOBPFXNVFWPF-HNNXBMFYSA-N |
| XLogP | 5.15 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|