C32H33ClN6O3S2 — CID 126356517
N-benzyl-2-[[2-[[5-[(1R)-1-[(4-chlorobenzoyl)amino]ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126356517) has the molecular formula C32H33ClN6O3S2 and a molecular weight of 649.24 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[5-[(1R)-1-[(4-chlorobenzoyl)amino]ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[2-[[5-[(1R)-1-[(4-chlorobenzoyl)amino]ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126356517 |
| Molecular Formula | C32H33ClN6O3S2 |
| Molecular Weight | 649.24 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | N-benzyl-2-[[2-[[5-[(1R)-1-[(4-chlorobenzoyl)amino]ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)NCc2ccccc2)CCCC3)nnc1[C@@H](C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H33ClN6O3S2/c1-3-17-39-28(20(2)35-29(41)22-13-15-23(33)16-14-22)37-38-32(39)43-19-26(40)36-31-27(24-11-7-8-12-25(24)44-31)30(42)34-18-21-9-5-4-6-10-21/h3-6,9-10,13-16,20H,1,7-8,11-12,17-19H2,2H3,(H,34,42)(H,35,41)(H,36,40)/t20-/m1/s1 |
| InChIKey | VWNCHCNHYFDVDH-HXUWFJFHSA-N |
| XLogP | 6.21 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.24 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|