C27H31N5O4S2 — CID 126360061
ethyl 2-[[2-[[5-[(1S)-1-benzamidoethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126360061) has the molecular formula C27H31N5O4S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(1S)-1-benzamidoethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(1S)-1-benzamidoethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126360061 |
| Molecular Formula | C27H31N5O4S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | ethyl 2-[[2-[[5-[(1S)-1-benzamidoethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OCC)CCCC3)nnc1[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H31N5O4S2/c1-4-15-32-23(17(3)28-24(34)18-11-7-6-8-12-18)30-31-27(32)37-16-21(33)29-25-22(26(35)36-5-2)19-13-9-10-14-20(19)38-25/h4,6-8,11-12,17H,1,5,9-10,13-16H2,2-3H3,(H,28,34)(H,29,33)/t17-/m0/s1 |
| InChIKey | IOJOMARNLHRZLR-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|