C26H29Cl2N5O4S2 — CID 126362430
ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126362430) has the molecular formula C26H29Cl2N5O4S2 and a molecular weight of 610.59 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126362430 |
| Molecular Formula | C26H29Cl2N5O4S2 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc([C@H](C)NC(=O)c3ccc(Cl)c(Cl)c3)n2CC)sc2c1CCCC2 |
| InChI | InChI=1S/C26H29Cl2N5O4S2/c1-4-33-22(14(3)29-23(35)15-10-11-17(27)18(28)12-15)31-32-26(33)38-13-20(34)30-24-21(25(36)37-5-2)16-8-6-7-9-19(16)39-24/h10-12,14H,4-9,13H2,1-3H3,(H,29,35)(H,30,34)/t14-/m0/s1 |
| InChIKey | JSPMCAGPBAYEIM-AWEZNQCLSA-N |
| XLogP | 5.94 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |