C25H30N6O3S2 — CID 4201814
2-[[2-[[4-ethyl-5-[1-[(3-methylbenzoyl)amino]ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4201814) has the molecular formula C25H30N6O3S2 and a molecular weight of 526.69 g/mol. Its IUPAC name is 2-[[2-[[4-ethyl-5-[1-[(3-methylbenzoyl)amino]ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[4-ethyl-5-[1-[(3-methylbenzoyl)amino]ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4201814 |
| Molecular Formula | C25H30N6O3S2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 2-[[2-[[4-ethyl-5-[1-[(3-methylbenzoyl)amino]ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCCC3)nnc1C(C)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C25H30N6O3S2/c1-4-31-22(15(3)27-23(34)16-9-7-8-14(2)12-16)29-30-25(31)35-13-19(32)28-24-20(21(26)33)17-10-5-6-11-18(17)36-24/h7-9,12,15H,4-6,10-11,13H2,1-3H3,(H2,26,33)(H,27,34)(H,28,32) |
| InChIKey | QJBYQFIVLVNNKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |