C24H28N4O3S2 — CID 19727988
ethyl 2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19727988) has the molecular formula C24H28N4O3S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19727988 |
| Molecular Formula | C24H28N4O3S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | ethyl 2-[[2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3ccccc3)n2CC)sc2c1CCCCC2 |
| InChI | InChI=1S/C24H28N4O3S2/c1-3-28-21(16-11-7-5-8-12-16)26-27-24(28)32-15-19(29)25-22-20(23(30)31-4-2)17-13-9-6-10-14-18(17)33-22/h5,7-8,11-12H,3-4,6,9-10,13-15H2,1-2H3,(H,25,29) |
| InChIKey | ZRRURAALCKXEQX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |