C23H25ClN4O3S2 — CID 19728695
methyl 2-[[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19728695) has the molecular formula C23H25ClN4O3S2 and a molecular weight of 505.07 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19728695 |
| Molecular Formula | C23H25ClN4O3S2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | methyl 2-[[2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCCCC3)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClN4O3S2/c1-3-28-20(14-9-11-15(24)12-10-14)26-27-23(28)32-13-18(29)25-21-19(22(30)31-2)16-7-5-4-6-8-17(16)33-21/h9-12H,3-8,13H2,1-2H3,(H,25,29) |
| InChIKey | ZIBWXVFCPWZPKT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |