C27H34N4O4S2 — CID 19732963
ethyl 2-[[2-[[4-ethyl-5-[4-(2-methylpropoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19732963) has the molecular formula C27H34N4O4S2 and a molecular weight of 542.73 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-ethyl-5-[4-(2-methylpropoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-ethyl-5-[4-(2-methylpropoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19732963 |
| Molecular Formula | C27H34N4O4S2 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | ethyl 2-[[2-[[4-ethyl-5-[4-(2-methylpropoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3ccc(OCC(C)C)cc3)n2CC)sc2c1CCCC2 |
| InChI | InChI=1S/C27H34N4O4S2/c1-5-31-24(18-11-13-19(14-12-18)35-15-17(3)4)29-30-27(31)36-16-22(32)28-25-23(26(33)34-6-2)20-9-7-8-10-21(20)37-25/h11-14,17H,5-10,15-16H2,1-4H3,(H,28,32) |
| InChIKey | MSWXBASRYHSBDI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |