C24H30N4O3S3 — CID 19719340
ethyl 2-[[2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19719340) has the molecular formula C24H30N4O3S3 and a molecular weight of 518.73 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19719340 |
| Molecular Formula | C24H30N4O3S3 |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | ethyl 2-[[2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCc1cc(-c2nnc(SCC(=O)Nc3sc4c(c3C(=O)OCC)CCCC4)n2CC)cs1 |
| InChI | InChI=1S/C24H30N4O3S3/c1-4-9-16-12-15(13-32-16)21-26-27-24(28(21)5-2)33-14-19(29)25-22-20(23(30)31-6-3)17-10-7-8-11-18(17)34-22/h12-13H,4-11,14H2,1-3H3,(H,25,29) |
| InChIKey | MHURPYMKQGVZFY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |