C25H30N4O3S3 — CID 19718731
propan-2-yl 2-[[2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19718731) has the molecular formula C25H30N4O3S3 and a molecular weight of 530.74 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19718731 |
| Molecular Formula | C25H30N4O3S3 |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | propan-2-yl 2-[[2-[[5-(5-ethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCC3)nnc1-c1csc(CC)c1 |
| InChI | InChI=1S/C25H30N4O3S3/c1-5-11-29-22(16-12-17(6-2)33-13-16)27-28-25(29)34-14-20(30)26-23-21(24(31)32-15(3)4)18-9-7-8-10-19(18)35-23/h5,12-13,15H,1,6-11,14H2,2-4H3,(H,26,30) |
| InChIKey | RZINCPWREMZJHM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|