C25H26F2N4O4S2 — CID 19643221
ethyl 2-[[2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19643221) has the molecular formula C25H26F2N4O4S2 and a molecular weight of 548.64 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19643221 |
| Molecular Formula | C25H26F2N4O4S2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | ethyl 2-[[2-[[5-[4-(difluoromethoxy)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OCC)CCCC3)nnc1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C25H26F2N4O4S2/c1-3-13-31-21(15-9-11-16(12-10-15)35-24(26)27)29-30-25(31)36-14-19(32)28-22-20(23(33)34-4-2)17-7-5-6-8-18(17)37-22/h3,9-12,24H,1,4-8,13-14H2,2H3,(H,28,32) |
| InChIKey | FJXHGNLFVRAXBZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|