C25H27Cl2N5O4S2 — CID 126370118
ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126370118) has the molecular formula C25H27Cl2N5O4S2 and a molecular weight of 596.56 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126370118 |
| Molecular Formula | C25H27Cl2N5O4S2 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | ethyl 2-[[2-[[5-[(1S)-1-[(3,4-dichlorobenzoyl)amino]ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc([C@H](C)NC(=O)c3ccc(Cl)c(Cl)c3)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C25H27Cl2N5O4S2/c1-4-36-24(35)20-15-7-5-6-8-18(15)38-23(20)29-19(33)12-37-25-31-30-21(32(25)3)13(2)28-22(34)14-9-10-16(26)17(27)11-14/h9-11,13H,4-8,12H2,1-3H3,(H,28,34)(H,29,33)/t13-/m0/s1 |
| InChIKey | ZCRDGJAEPKHLJU-ZDUSSCGKSA-N |
| XLogP | 5.46 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |