C22H23ClN4O3S2 — CID 19728080
ethyl 2-[[2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19728080) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19728080 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | ethyl 2-[[2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3ccccc3Cl)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C22H23ClN4O3S2/c1-3-30-21(29)18-14-9-5-7-11-16(14)32-20(18)24-17(28)12-31-22-26-25-19(27(22)2)13-8-4-6-10-15(13)23/h4,6,8,10H,3,5,7,9,11-12H2,1-2H3,(H,24,28) |
| InChIKey | LETFPIKTNRFPJE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |