C26H28ClN5O4S2 — CID 126370652
ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126370652) has the molecular formula C26H28ClN5O4S2 and a molecular weight of 574.13 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126370652 |
| Molecular Formula | C26H28ClN5O4S2 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)/C=C/c3ccccc3Cl)n2C)sc2c1CCCC2 |
| InChI | InChI=1S/C26H28ClN5O4S2/c1-3-36-25(35)23-17-9-5-7-11-19(17)38-24(23)29-22(34)15-37-26-31-30-20(32(26)2)14-28-21(33)13-12-16-8-4-6-10-18(16)27/h4,6,8,10,12-13H,3,5,7,9,11,14-15H2,1-2H3,(H,28,33)(H,29,34)/b13-12+ |
| InChIKey | ZZUWUANPPHLWMF-OUKQBFOZSA-N |
| XLogP | 4.65 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|