C21H21ClN2O3S2 — CID 4508704
ethyl 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4508704) has the molecular formula C21H21ClN2O3S2 and a molecular weight of 449.00 g/mol. Its IUPAC name is ethyl 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4508704 |
| Molecular Formula | C21H21ClN2O3S2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | ethyl 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)C=Cc2ccccc2Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C21H21ClN2O3S2/c1-2-27-20(26)18-14-8-4-6-10-16(14)29-19(18)24-21(28)23-17(25)12-11-13-7-3-5-9-15(13)22/h3,5,7,9,11-12H,2,4,6,8,10H2,1H3,(H2,23,24,25,28) |
| InChIKey | OVFSLIMGTHZTII-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|