C27H30ClN5O4S2 — CID 126365834
ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126365834) has the molecular formula C27H30ClN5O4S2 and a molecular weight of 588.16 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126365834 |
| Molecular Formula | C27H30ClN5O4S2 |
| Molecular Weight | 588.16 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | ethyl 2-[[2-[[5-[[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(CNC(=O)/C=C/c3ccccc3Cl)n2CC)sc2c1CCCC2 |
| InChI | InChI=1S/C27H30ClN5O4S2/c1-3-33-21(15-29-22(34)14-13-17-9-5-7-11-19(17)28)31-32-27(33)38-16-23(35)30-25-24(26(36)37-4-2)18-10-6-8-12-20(18)39-25/h5,7,9,11,13-14H,3-4,6,8,10,12,15-16H2,1-2H3,(H,29,34)(H,30,35)/b14-13+ |
| InChIKey | PFMNJBVUCXEWKA-BUHFOSPRSA-N |
| XLogP | 5.13 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.16 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|