C22H24ClNO3S — CID 93030345
ethyl 2-[[(Z)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 93030345) has the molecular formula C22H24ClNO3S and a molecular weight of 417.96 g/mol. Its IUPAC name is ethyl 2-[[(Z)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(Z)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 93030345 |
| Molecular Formula | C22H24ClNO3S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl 2-[[(Z)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C=C\c2ccccc2Cl)sc2c1CCCCCC2 |
| InChI | InChI=1S/C22H24ClNO3S/c1-2-27-22(26)20-16-10-5-3-4-6-12-18(16)28-21(20)24-19(25)14-13-15-9-7-8-11-17(15)23/h7-9,11,13-14H,2-6,10,12H2,1H3,(H,24,25)/b14-13- |
| InChIKey | KNEUEEUACNKIHI-YPKPFQOOSA-N |
| XLogP | 5.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|