C20H21ClN2O2S — CID 1001248
2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 1001248) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is 2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 1001248 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)/C=C/c2ccccc2Cl)sc2c1CCCCCC2 |
| InChI | InChI=1S/C20H21ClN2O2S/c21-15-9-6-5-7-13(15)11-12-17(24)23-20-18(19(22)25)14-8-3-1-2-4-10-16(14)26-20/h5-7,9,11-12H,1-4,8,10H2,(H2,22,25)(H,23,24)/b12-11+ |
| InChIKey | YPUMJSFWUGEOFL-VAWYXSNFSA-N |
| XLogP | 4.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|