C26H25ClN2O2S — CID 3333169
2-[3-(2-chlorophenyl)prop-2-enoylamino]-N-(2-phenylethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3333169) has the molecular formula C26H25ClN2O2S and a molecular weight of 465.02 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)prop-2-enoylamino]-N-(2-phenylethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-(2-chlorophenyl)prop-2-enoylamino]-N-(2-phenylethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3333169 |
| Molecular Formula | C26H25ClN2O2S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[3-(2-chlorophenyl)prop-2-enoylamino]-N-(2-phenylethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(C=Cc1ccccc1Cl)Nc1sc2c(c1C(=O)NCCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C26H25ClN2O2S/c27-21-12-6-4-10-19(21)14-15-23(30)29-26-24(20-11-5-7-13-22(20)32-26)25(31)28-17-16-18-8-2-1-3-9-18/h1-4,6,8-10,12,14-15H,5,7,11,13,16-17H2,(H,28,31)(H,29,30) |
| InChIKey | LPFDVSITMZTTAB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|