C26H32ClNO3S — CID 4157338
ethyl 2-[3-(2-chlorophenyl)prop-2-enoylamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate (PubChem CID 4157338) has the molecular formula C26H32ClNO3S and a molecular weight of 474.07 g/mol. Its IUPAC name is ethyl 2-[3-(2-chlorophenyl)prop-2-enoylamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(2-chlorophenyl)prop-2-enoylamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4157338 |
| Molecular Formula | C26H32ClNO3S |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl 2-[3-(2-chlorophenyl)prop-2-enoylamino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccccc2Cl)sc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C26H32ClNO3S/c1-2-31-26(30)24-20-14-9-7-5-3-4-6-8-10-16-22(20)32-25(24)28-23(29)18-17-19-13-11-12-15-21(19)27/h11-13,15,17-18H,2-10,14,16H2,1H3,(H,28,29) |
| InChIKey | LPZQNQYXOIDUMH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|