C17H14Cl2N2O2S — CID 4503672
2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 4503672) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4503672 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C=Cc2ccc(Cl)cc2Cl)sc2c1CCC2 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c18-10-6-4-9(12(19)8-10)5-7-14(22)21-17-15(16(20)23)11-2-1-3-13(11)24-17/h4-8H,1-3H2,(H2,20,23)(H,21,22) |
| InChIKey | GMODQMUPNUTKSA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|