C18H15Cl2NO3S — CID 1219751
methyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 1219751) has the molecular formula C18H15Cl2NO3S and a molecular weight of 396.30 g/mol. Its IUPAC name is methyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1219751 |
| Molecular Formula | C18H15Cl2NO3S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | methyl 2-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C=Cc2ccc(Cl)cc2Cl)sc2c1CCC2 |
| InChI | InChI=1S/C18H15Cl2NO3S/c1-24-18(23)16-12-3-2-4-14(12)25-17(16)21-15(22)8-6-10-5-7-11(19)9-13(10)20/h5-9H,2-4H2,1H3,(H,21,22) |
| InChIKey | BBIJCBRUAKPTSP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|