C17H14Cl2N2O4S — CID 17285268
methyl 5-carbamoyl-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 17285268) has the molecular formula C17H14Cl2N2O4S and a molecular weight of 413.28 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17285268 |
| Molecular Formula | C17H14Cl2N2O4S |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | methyl 5-carbamoyl-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C=C/c2ccc(Cl)cc2Cl)sc(C(N)=O)c1C |
| InChI | InChI=1S/C17H14Cl2N2O4S/c1-8-13(17(24)25-2)16(26-14(8)15(20)23)21-12(22)6-4-9-3-5-10(18)7-11(9)19/h3-7H,1-2H3,(H2,20,23)(H,21,22)/b6-4+ |
| InChIKey | ADNSNLZDZOAITR-GQCTYLIASA-N |
| XLogP | 3.90 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|