C22H23Cl2NO5S — CID 4128849
dipropan-2-yl 5-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4128849) has the molecular formula C22H23Cl2NO5S and a molecular weight of 484.40 g/mol. Its IUPAC name is dipropan-2-yl 5-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4128849 |
| Molecular Formula | C22H23Cl2NO5S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | dipropan-2-yl 5-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)C=Cc2ccc(Cl)cc2Cl)c1C(=O)OC(C)C |
| InChI | InChI=1S/C22H23Cl2NO5S/c1-11(2)29-21(27)18-13(5)19(22(28)30-12(3)4)31-20(18)25-17(26)9-7-14-6-8-15(23)10-16(14)24/h6-12H,1-5H3,(H,25,26) |
| InChIKey | WUFBAKHRGYAOQZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|