C23H25NO7S — CID 1371064
dipropan-2-yl 5-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 1371064) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is dipropan-2-yl 5-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 1371064 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | dipropan-2-yl 5-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)/C=C/c2ccc3c(c2)OCO3)c1C(=O)OC(C)C |
| InChI | InChI=1S/C23H25NO7S/c1-12(2)30-22(26)19-14(5)20(23(27)31-13(3)4)32-21(19)24-18(25)9-7-15-6-8-16-17(10-15)29-11-28-16/h6-10,12-13H,11H2,1-5H3,(H,24,25)/b9-7+ |
| InChIKey | AHMALSNAWPWMSB-VQHVLOKHSA-N |
| XLogP | 4.57 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|