C26H33NO5S — CID 6367712
dipropan-2-yl 5-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 6367712) has the molecular formula C26H33NO5S and a molecular weight of 471.62 g/mol. Its IUPAC name is dipropan-2-yl 5-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dipropan-2-yl 5-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 6367712 |
| Molecular Formula | C26H33NO5S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | dipropan-2-yl 5-[[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)/C=C/c2ccc(C(C)(C)C)cc2)c1C(=O)OC(C)C |
| InChI | InChI=1S/C26H33NO5S/c1-15(2)31-24(29)21-17(5)22(25(30)32-16(3)4)33-23(21)27-20(28)14-11-18-9-12-19(13-10-18)26(6,7)8/h9-16H,1-8H3,(H,27,28)/b14-11+ |
| InChIKey | KCYDIOZGWFEARY-SDNWHVSQSA-N |
| XLogP | 6.14 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|