C22H24BrNO5S — CID 4598318
2-O-tert-butyl 4-O-ethyl 5-[3-(4-bromophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4598318) has the molecular formula C22H24BrNO5S and a molecular weight of 494.41 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-ethyl 5-[3-(4-bromophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-ethyl 5-[3-(4-bromophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4598318 |
| Molecular Formula | C22H24BrNO5S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-O-tert-butyl 4-O-ethyl 5-[3-(4-bromophenyl)prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(Br)cc2)sc(C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C22H24BrNO5S/c1-6-28-20(26)17-13(2)18(21(27)29-22(3,4)5)30-19(17)24-16(25)12-9-14-7-10-15(23)11-8-14/h7-12H,6H2,1-5H3,(H,24,25) |
| InChIKey | ZAIQUQWGTVYFDG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|