C21H23BrN2O4S — CID 6111834
methyl 2-[[(E)-3-(4-bromophenyl)prop-2-enoyl]amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 6111834) has the molecular formula C21H23BrN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(4-bromophenyl)prop-2-enoyl]amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-3-(4-bromophenyl)prop-2-enoyl]amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6111834 |
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | methyl 2-[[(E)-3-(4-bromophenyl)prop-2-enoyl]amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)/C=C/c2ccc(Br)cc2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C21H23BrN2O4S/c1-5-24(6-2)20(26)18-13(3)17(21(27)28-4)19(29-18)23-16(25)12-9-14-7-10-15(22)11-8-14/h7-12H,5-6H2,1-4H3,(H,23,25)/b12-9+ |
| InChIKey | VNLFNHKWISPQHU-FMIVXFBMSA-N |
| XLogP | 4.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|