C24H30N2O6S — CID 5065200
ethyl 5-(diethylcarbamoyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 5065200) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is ethyl 5-(diethylcarbamoyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(diethylcarbamoyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5065200 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | ethyl 5-(diethylcarbamoyl)-2-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(OC)c(OC)c2)sc(C(=O)N(CC)CC)c1C |
| InChI | InChI=1S/C24H30N2O6S/c1-7-26(8-2)23(28)21-15(4)20(24(29)32-9-3)22(33-21)25-19(27)13-11-16-10-12-17(30-5)18(14-16)31-6/h10-14H,7-9H2,1-6H3,(H,25,27) |
| InChIKey | CAXLVGDQGBXLKV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|