C24H29NO7S — CID 6271718
diethyl 5-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 6271718) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is diethyl 5-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 6271718 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | diethyl 5-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2sc(C(=O)OCC)c(C)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C24H29NO7S/c1-6-13-32-17-11-9-16(14-18(17)29-5)10-12-19(26)25-22-20(23(27)30-7-2)15(4)21(33-22)24(28)31-8-3/h9-12,14H,6-8,13H2,1-5H3,(H,25,26)/b12-10+ |
| InChIKey | FOSFBCSQTMHVKZ-ZRDIBKRKSA-N |
| XLogP | 4.86 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|