C23H26ClNO6 — CID 19226877
ethyl 5-chloro-2-methoxy-4-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19226877) has the molecular formula C23H26ClNO6 and a molecular weight of 447.92 g/mol. Its IUPAC name is ethyl 5-chloro-2-methoxy-4-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 5-chloro-2-methoxy-4-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19226877 |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | ethyl 5-chloro-2-methoxy-4-[[(E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2cc(OC)c(C(=O)OCC)cc2Cl)cc1OC |
| InChI | InChI=1S/C23H26ClNO6/c1-5-11-31-19-9-7-15(12-21(19)29-4)8-10-22(26)25-18-14-20(28-3)16(13-17(18)24)23(27)30-6-2/h7-10,12-14H,5-6,11H2,1-4H3,(H,25,26)/b10-8+ |
| InChIKey | KZAQQOYDZVLCQS-CSKARUKUSA-N |
| XLogP | 4.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|